C20H21FN4OS — CID 9194768
N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-4-fluorobenzamide (PubChem CID 9194768) has the molecular formula C20H21FN4OS and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-4-fluorobenzamide.
| Compound Name | N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 9194768 |
| Molecular Formula | C20H21FN4OS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-4-fluorobenzamide |
| SMILES | CC[C@@H]1CN=C(Nc2ccc(/C(C)=N\NC(=O)c3ccc(F)cc3)cc2)S1 |
| InChI | InChI=1S/C20H21FN4OS/c1-3-18-12-22-20(27-18)23-17-10-6-14(7-11-17)13(2)24-25-19(26)15-4-8-16(21)9-5-15/h4-11,18H,3,12H2,1-2H3,(H,22,23)(H,25,26)/b24-13-/t18-/m1/s1 |
| InChIKey | LBRGKJKNPRIVPG-WTZXFZKGSA-N |
| XLogP | 4.27 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|