C15H21N5S2 — CID 9212018
1-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-3-methylthiourea (PubChem CID 9212018) has the molecular formula C15H21N5S2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 1-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-3-methylthiourea.
| Compound Name | 1-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 9212018 |
| Molecular Formula | C15H21N5S2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-3-methylthiourea |
| SMILES | CC[C@@H]1CN=C(Nc2ccc(/C(C)=N\NC(=S)NC)cc2)S1 |
| InChI | InChI=1S/C15H21N5S2/c1-4-13-9-17-15(22-13)18-12-7-5-11(6-8-12)10(2)19-20-14(21)16-3/h5-8,13H,4,9H2,1-3H3,(H,17,18)(H2,16,20,21)/b19-10-/t13-/m1/s1 |
| InChIKey | KIVZQJOZEMBFPF-XTBHVRTMSA-N |
| XLogP | 2.80 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|