C20H22N4O2S — CID 9234504
N-[(Z)-1-[4-[[(5S)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-3-hydroxybenzamide (PubChem CID 9234504) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[(Z)-1-[4-[[(5S)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-3-hydroxybenzamide.
| Compound Name | N-[(Z)-1-[4-[[(5S)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 9234504 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[(Z)-1-[4-[[(5S)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-3-hydroxybenzamide |
| SMILES | CC[C@H]1CN=C(Nc2ccc(/C(C)=N\NC(=O)c3cccc(O)c3)cc2)S1 |
| InChI | InChI=1S/C20H22N4O2S/c1-3-18-12-21-20(27-18)22-16-9-7-14(8-10-16)13(2)23-24-19(26)15-5-4-6-17(25)11-15/h4-11,18,25H,3,12H2,1-2H3,(H,21,22)(H,24,26)/b23-13-/t18-/m0/s1 |
| InChIKey | PMWPHUDVKYGUSO-QRAWFLTRSA-N |
| XLogP | 3.84 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|