C20H24N4O2S — CID 9215333
N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-2,5-dimethylfuran-3-carboxamide (PubChem CID 9215333) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 9215333 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-2,5-dimethylfuran-3-carboxamide |
| SMILES | CC[C@@H]1CN=C(Nc2ccc(/C(C)=N\NC(=O)c3cc(C)oc3C)cc2)S1 |
| InChI | InChI=1S/C20H24N4O2S/c1-5-17-11-21-20(27-17)22-16-8-6-15(7-9-16)13(3)23-24-19(25)18-10-12(2)26-14(18)4/h6-10,17H,5,11H2,1-4H3,(H,21,22)(H,24,25)/b23-13-/t17-/m1/s1 |
| InChIKey | NRISSYKUTDLBFS-SUVVMJBMSA-N |
| XLogP | 4.34 |
| TPSA | 78.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|