C19H23N5OS2 — CID 9231822
N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 9231822) has the molecular formula C19H23N5OS2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 9231822 |
| Molecular Formula | C19H23N5OS2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[(Z)-1-[4-[[(5R)-5-ethyl-4,5-dihydro-1,3-thiazol-2-yl]amino]phenyl]ethylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CC[C@@H]1CN=C(Nc2ccc(/C(C)=N\NC(=O)Cc3csc(C)n3)cc2)S1 |
| InChI | InChI=1S/C19H23N5OS2/c1-4-17-10-20-19(27-17)22-15-7-5-14(6-8-15)12(2)23-24-18(25)9-16-11-26-13(3)21-16/h5-8,11,17H,4,9-10H2,1-3H3,(H,20,22)(H,24,25)/b23-12-/t17-/m1/s1 |
| InChIKey | KZDVMLXXRZHQHU-NSTHGIQOSA-N |
| XLogP | 3.83 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|