C23H19F3N4O2 — CID 91955165
N-(3-indazol-1-ylpropyl)-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 91955165) has the molecular formula C23H19F3N4O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is N-(3-indazol-1-ylpropyl)-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-(3-indazol-1-ylpropyl)-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91955165 |
| Molecular Formula | C23H19F3N4O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(3-indazol-1-ylpropyl)-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCn1ncc2ccccc21)c1ccc(=O)n(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H19F3N4O2/c24-23(25,26)18-6-3-7-19(13-18)29-15-17(9-10-21(29)31)22(32)27-11-4-12-30-20-8-2-1-5-16(20)14-28-30/h1-3,5-10,13-15H,4,11-12H2,(H,27,32) |
| InChIKey | OOFJXSFZXQDHKY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|