C15H22BrN3O3 — CID 9205744
2-(2-bromo-4,5-dimethoxyphenyl)-N-(4-methylpiperazin-1-yl)acetamide (PubChem CID 9205744) has the molecular formula C15H22BrN3O3 and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-N-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 9205744 |
| Molecular Formula | C15H22BrN3O3 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-(4-methylpiperazin-1-yl)acetamide |
| SMILES | COc1cc(Br)c(CC(=O)NN2CCN(C)CC2)cc1OC |
| InChI | InChI=1S/C15H22BrN3O3/c1-18-4-6-19(7-5-18)17-15(20)9-11-8-13(21-2)14(22-3)10-12(11)16/h8,10H,4-7,9H2,1-3H3,(H,17,20) |
| InChIKey | QZNJRYKIKWSYOW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |