C15H27N3O2 — CID 9225449
[(2S)-1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 9225449) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is [(2S)-1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2S)-1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 9225449 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | [(2S)-1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)[C@H](NC(N)=O)C(=O)N1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C15H27N3O2/c1-10(2)13(17-15(16)20)14(19)18-8-7-11-5-3-4-6-12(11)9-18/h10-13H,3-9H2,1-2H3,(H3,16,17,20)/t11-,12-,13+/m1/s1 |
| InChIKey | FKLMHIYGVUVCPK-UPJWGTAASA-N |
| XLogP | 1.72 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |