C14H15N3O — CID 9241680
1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-phenylurea (PubChem CID 9241680) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-phenylurea.
| Compound Name | 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-phenylurea |
|---|---|
| PubChem CID | 9241680 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-phenylurea |
| SMILES | O=C(N/N=C1/C[C@H]2C=CC[C@@H]12)Nc1ccccc1 |
| InChI | InChI=1S/C14H15N3O/c18-14(15-11-6-2-1-3-7-11)17-16-13-9-10-5-4-8-12(10)13/h1-7,10,12H,8-9H2,(H2,15,17,18)/b16-13-/t10-,12-/m1/s1 |
| InChIKey | YUGZCAJKPHMYHV-KTIPYJLNSA-N |
| XLogP | 2.76 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|