C13H13ClN2 — CID 9070021
N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-chloroaniline (PubChem CID 9070021) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-chloroaniline.
| Compound Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-chloroaniline |
|---|---|
| PubChem CID | 9070021 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-chloroaniline |
| SMILES | Clc1ccccc1N/N=C1/C[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C13H13ClN2/c14-11-6-1-2-7-12(11)15-16-13-8-9-4-3-5-10(9)13/h1-4,6-7,9-10,15H,5,8H2/b16-13-/t9-,10-/m0/s1 |
| InChIKey | MKVCNEYSJGXAOS-XYMKADJISA-N |
| XLogP | 3.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|