C15H13ClF3N3S — CID 40880217
1-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 40880217) has the molecular formula C15H13ClF3N3S and a molecular weight of 359.80 g/mol. Its IUPAC name is 1-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 40880217 |
| Molecular Formula | C15H13ClF3N3S |
| Molecular Weight | 359.80 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1ccc(Cl)c(NC(=S)N/N=C2/C[C@@H]3C=CC[C@@H]23)c1 |
| InChI | InChI=1S/C15H13ClF3N3S/c16-11-5-4-9(15(17,18)19)7-13(11)20-14(23)22-21-12-6-8-2-1-3-10(8)12/h1-2,4-5,7-8,10H,3,6H2,(H2,20,22,23)/b21-12-/t8-,10+/m0/s1 |
| InChIKey | OOLPSPFENZMUGE-GGVQKYQNSA-N |
| XLogP | 4.60 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|