C17H21ClF3N3S — CID 2426895
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]thiourea (PubChem CID 2426895) has the molecular formula C17H21ClF3N3S and a molecular weight of 391.89 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]thiourea |
|---|---|
| PubChem CID | 2426895 |
| Molecular Formula | C17H21ClF3N3S |
| Molecular Weight | 391.89 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]thiourea |
| SMILES | C[C@@H]1CC(NNC(=S)Nc2cc(C(F)(F)F)ccc2Cl)=CC(C)(C)C1 |
| InChI | InChI=1S/C17H21ClF3N3S/c1-10-6-12(9-16(2,3)8-10)23-24-15(25)22-14-7-11(17(19,20)21)4-5-13(14)18/h4-5,7,9-10,23H,6,8H2,1-3H3,(H2,22,24,25)/t10-/m1/s1 |
| InChIKey | UKGSAADSFKRPHG-SNVBAGLBSA-N |
| XLogP | 5.49 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.89 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|