C23H17ClF3N3S — CID 2438121
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[1-(9H-fluoren-2-yl)ethenylamino]thiourea (PubChem CID 2438121) has the molecular formula C23H17ClF3N3S and a molecular weight of 459.92 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[1-(9H-fluoren-2-yl)ethenylamino]thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[1-(9H-fluoren-2-yl)ethenylamino]thiourea |
|---|---|
| PubChem CID | 2438121 |
| Molecular Formula | C23H17ClF3N3S |
| Molecular Weight | 459.92 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[1-(9H-fluoren-2-yl)ethenylamino]thiourea |
| SMILES | C=C(NNC(=S)Nc1cc(C(F)(F)F)ccc1Cl)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C23H17ClF3N3S/c1-13(14-6-8-19-16(10-14)11-15-4-2-3-5-18(15)19)29-30-22(31)28-21-12-17(23(25,26)27)7-9-20(21)24/h2-10,12,29H,1,11H2,(H2,28,30,31) |
| InChIKey | HEWCYDKSNSSXMV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.92 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|