C15H16ClN3S — CID 9316293
1-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-(3-chloro-2-methylphenyl)thiourea (PubChem CID 9316293) has the molecular formula C15H16ClN3S and a molecular weight of 305.83 g/mol. Its IUPAC name is 1-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-(3-chloro-2-methylphenyl)thiourea.
| Compound Name | 1-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-(3-chloro-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 9316293 |
| Molecular Formula | C15H16ClN3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-(3-chloro-2-methylphenyl)thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N/N=C1/C[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C15H16ClN3S/c1-9-12(16)6-3-7-13(9)17-15(20)19-18-14-8-10-4-2-5-11(10)14/h2-4,6-7,10-11H,5,8H2,1H3,(H2,17,19,20)/b18-14-/t10-,11-/m0/s1 |
| InChIKey | PVVRXAMIAHXPLW-FMVACOBOSA-N |
| XLogP | 3.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|