C16H19NO5S — CID 92501766
7-methoxy-3-[(3R)-3-methylpiperidin-1-yl]sulfonylchromen-2-one (PubChem CID 92501766) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 7-methoxy-3-[(3R)-3-methylpiperidin-1-yl]sulfonylchromen-2-one.
| Compound Name | 7-methoxy-3-[(3R)-3-methylpiperidin-1-yl]sulfonylchromen-2-one |
|---|---|
| PubChem CID | 92501766 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 7-methoxy-3-[(3R)-3-methylpiperidin-1-yl]sulfonylchromen-2-one |
| SMILES | COc1ccc2cc(S(=O)(=O)N3CCC[C@@H](C)C3)c(=O)oc2c1 |
| InChI | InChI=1S/C16H19NO5S/c1-11-4-3-7-17(10-11)23(19,20)15-8-12-5-6-13(21-2)9-14(12)22-16(15)18/h5-6,8-9,11H,3-4,7,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | JNMPLMDVNNZKIP-LLVKDONJSA-N |
| XLogP | 2.22 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|