C21H26N2O — CID 92524928
[(1S,2Z)-2-(dimethylhydrazinylidene)cyclohexyl]-diphenylmethanol (PubChem CID 92524928) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is [(1S,2Z)-2-(dimethylhydrazinylidene)cyclohexyl]-diphenylmethanol.
| Compound Name | [(1S,2Z)-2-(dimethylhydrazinylidene)cyclohexyl]-diphenylmethanol |
|---|---|
| PubChem CID | 92524928 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | [(1S,2Z)-2-(dimethylhydrazinylidene)cyclohexyl]-diphenylmethanol |
| SMILES | CN(C)/N=C1/CCCC[C@@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O/c1-23(2)22-20-16-10-9-15-19(20)21(24,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-8,11-14,19,24H,9-10,15-16H2,1-2H3/b22-20-/t19-/m0/s1 |
| InChIKey | GHABZPGWMZILRE-MMDUXOIOSA-N |
| XLogP | 4.03 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|