C22H32N6O5 — CID 92528691
8-(diethylamino)-7-[3-[[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 92528691) has the molecular formula C22H32N6O5 and a molecular weight of 460.54 g/mol. Its IUPAC name is 8-(diethylamino)-7-[3-[[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(diethylamino)-7-[3-[[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 92528691 |
| Molecular Formula | C22H32N6O5 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 8-(diethylamino)-7-[3-[[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCN(CC)c1nc2c(c(=O)n(C)c(=O)n2C)n1CCCNC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H32N6O5/c1-5-27(6-2)21-24-19-18(20(32)26(4)22(33)25(19)3)28(21)11-7-10-23-13-17(31)14-8-9-15(29)16(30)12-14/h8-9,12,17,23,29-31H,5-7,10-11,13H2,1-4H3/t17-/m0/s1 |
| InChIKey | DVESNKWJVUEVML-KRWDZBQOSA-N |
| XLogP | 0.40 |
| TPSA | 137.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|