C17H12Cl2N6O3 — CID 92531166
(2Z,3S)-N-(2,4-dichlorophenyl)-2-hydrazinylidene-3-nitro-3-quinoxalin-2-ylpropanamide (PubChem CID 92531166) has the molecular formula C17H12Cl2N6O3 and a molecular weight of 419.23 g/mol. Its IUPAC name is (2Z,3S)-N-(2,4-dichlorophenyl)-2-hydrazinylidene-3-nitro-3-quinoxalin-2-ylpropanamide.
| Compound Name | (2Z,3S)-N-(2,4-dichlorophenyl)-2-hydrazinylidene-3-nitro-3-quinoxalin-2-ylpropanamide |
|---|---|
| PubChem CID | 92531166 |
| Molecular Formula | C17H12Cl2N6O3 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | (2Z,3S)-N-(2,4-dichlorophenyl)-2-hydrazinylidene-3-nitro-3-quinoxalin-2-ylpropanamide |
| SMILES | N/N=C(\C(=O)Nc1ccc(Cl)cc1Cl)[C@H](c1cnc2ccccc2n1)[N+](=O)[O-] |
| InChI | InChI=1S/C17H12Cl2N6O3/c18-9-5-6-11(10(19)7-9)23-17(26)15(24-20)16(25(27)28)14-8-21-12-3-1-2-4-13(12)22-14/h1-8,16H,20H2,(H,23,26)/b24-15-/t16-/m0/s1 |
| InChIKey | YOQHIYIFYQFBMO-PHQOBFFQSA-N |
| XLogP | 3.21 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|