C22H22N2O5 — CID 92604207
(3R,4R,5S)-N-[(2,4-dimethoxyphenyl)methyl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 92604207) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (3R,4R,5S)-N-[(2,4-dimethoxyphenyl)methyl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (3R,4R,5S)-N-[(2,4-dimethoxyphenyl)methyl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 92604207 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (3R,4R,5S)-N-[(2,4-dimethoxyphenyl)methyl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@H]2[C@@H]3C(=O)Nc4ccccc4C(=O)[C@]23C)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-22-17(18(22)21(27)24-15-7-5-4-6-14(15)19(22)25)20(26)23-11-12-8-9-13(28-2)10-16(12)29-3/h4-10,17-18H,11H2,1-3H3,(H,23,26)(H,24,27)/t17-,18+,22+/m0/s1 |
| InChIKey | WGQBPFIEQBUTBH-NJNPRVFISA-N |
| XLogP | 2.41 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |