C18H16N2O3S — CID 92604213
(3R,4R,5S)-3-methyl-2,6-dioxo-N-(thiophen-2-ylmethyl)-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 92604213) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is (3R,4R,5S)-3-methyl-2,6-dioxo-N-(thiophen-2-ylmethyl)-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (3R,4R,5S)-3-methyl-2,6-dioxo-N-(thiophen-2-ylmethyl)-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 92604213 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (3R,4R,5S)-3-methyl-2,6-dioxo-N-(thiophen-2-ylmethyl)-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | C[C@]12C(=O)c3ccccc3NC(=O)[C@H]1[C@H]2C(=O)NCc1cccs1 |
| InChI | InChI=1S/C18H16N2O3S/c1-18-13(16(22)19-9-10-5-4-8-24-10)14(18)17(23)20-12-7-3-2-6-11(12)15(18)21/h2-8,13-14H,9H2,1H3,(H,19,22)(H,20,23)/t13-,14+,18+/m0/s1 |
| InChIKey | GZKTYINZUADBEI-PMUMKWKESA-N |
| XLogP | 2.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |