C13H11NO4 — CID 73440626
(3S,4R,5S)-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxylic acid (PubChem CID 73440626) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is (3S,4R,5S)-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxylic acid.
| Compound Name | (3S,4R,5S)-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 73440626 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3S,4R,5S)-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxylic acid |
| SMILES | C[C@]12C(=O)c3ccccc3NC(=O)[C@H]1[C@H]2C(=O)O |
| InChI | InChI=1S/C13H11NO4/c1-13-8(9(13)12(17)18)11(16)14-7-5-3-2-4-6(7)10(13)15/h2-5,8-9H,1H3,(H,14,16)(H,17,18)/t8-,9+,13+/m1/s1 |
| InChIKey | DTXNYXBSRUBHFE-ZDMBXUJBSA-N |
| XLogP | 1.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |