C20H25N3O4 — CID 110224236
(3S,4R)-4-[4-(2-methoxyethyl)piperazine-1-carbonyl]-3-methyl-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-2,6-dione (PubChem CID 110224236) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (3S,4R)-4-[4-(2-methoxyethyl)piperazine-1-carbonyl]-3-methyl-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-2,6-dione.
| Compound Name | (3S,4R)-4-[4-(2-methoxyethyl)piperazine-1-carbonyl]-3-methyl-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 110224236 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (3S,4R)-4-[4-(2-methoxyethyl)piperazine-1-carbonyl]-3-methyl-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-2,6-dione |
| SMILES | COCCN1CCN(C(=O)[C@@H]2C3C(=O)Nc4ccccc4C(=O)[C@@]32C)CC1 |
| InChI | InChI=1S/C20H25N3O4/c1-20-15(18(25)21-14-6-4-3-5-13(14)17(20)24)16(20)19(26)23-9-7-22(8-10-23)11-12-27-2/h3-6,15-16H,7-12H2,1-2H3,(H,21,25)/t15?,16-,20-/m0/s1 |
| InChIKey | YELASBLNYHJEAH-LQGBDCMISA-N |
| XLogP | 0.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |