C18H23N3O3 — CID 98132417
(3R,4R,5R)-N-[(2R)-1-(dimethylamino)propan-2-yl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 98132417) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3R,4R,5R)-N-[(2R)-1-(dimethylamino)propan-2-yl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (3R,4R,5R)-N-[(2R)-1-(dimethylamino)propan-2-yl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 98132417 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (3R,4R,5R)-N-[(2R)-1-(dimethylamino)propan-2-yl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | C[C@H](CN(C)C)NC(=O)[C@@H]1[C@H]2C(=O)Nc3ccccc3C(=O)[C@@]21C |
| InChI | InChI=1S/C18H23N3O3/c1-10(9-21(3)4)19-16(23)13-14-17(24)20-12-8-6-5-7-11(12)15(22)18(13,14)2/h5-8,10,13-14H,9H2,1-4H3,(H,19,23)(H,20,24)/t10-,13+,14+,18-/m1/s1 |
| InChIKey | MGOZMLRWYDSPIC-BVSJBKOGSA-N |
| XLogP | 1.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |