C23H32N4O3 — CID 110224265
(3R,4R)-N-[2,2-dimethyl-3-(4-methylpiperazin-1-yl)propyl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 110224265) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is (3R,4R)-N-[2,2-dimethyl-3-(4-methylpiperazin-1-yl)propyl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (3R,4R)-N-[2,2-dimethyl-3-(4-methylpiperazin-1-yl)propyl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 110224265 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (3R,4R)-N-[2,2-dimethyl-3-(4-methylpiperazin-1-yl)propyl]-3-methyl-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | CN1CCN(CC(C)(C)CNC(=O)[C@@H]2C3C(=O)Nc4ccccc4C(=O)[C@@]32C)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-22(2,14-27-11-9-26(4)10-12-27)13-24-20(29)17-18-21(30)25-16-8-6-5-7-15(16)19(28)23(17,18)3/h5-8,17-18H,9-14H2,1-4H3,(H,24,29)(H,25,30)/t17-,18?,23+/m0/s1 |
| InChIKey | ZGXLLZCZEVILQJ-MMQQLJCSSA-N |
| XLogP | 1.46 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |