C19H23N3O4 — CID 110224229
(3R,4R)-3-methyl-N-(2-morpholin-4-ylethyl)-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 110224229) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is (3R,4R)-3-methyl-N-(2-morpholin-4-ylethyl)-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (3R,4R)-3-methyl-N-(2-morpholin-4-ylethyl)-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 110224229 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (3R,4R)-3-methyl-N-(2-morpholin-4-ylethyl)-2,6-dioxo-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | C[C@]12C(=O)c3ccccc3NC(=O)C1[C@H]2C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C19H23N3O4/c1-19-14(17(24)20-6-7-22-8-10-26-11-9-22)15(19)18(25)21-13-5-3-2-4-12(13)16(19)23/h2-5,14-15H,6-11H2,1H3,(H,20,24)(H,21,25)/t14-,15?,19+/m0/s1 |
| InChIKey | RFXFUTXPPIAIDT-CTHAPGQVSA-N |
| XLogP | 0.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |