About (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine
(3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 92628575) has the molecular formula C17H19ClN4O2S
and a molecular weight of 378.89 g/mol. Its IUPAC name is (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine |
| PubChem CID | 92628575 |
| Molecular Formula | C17H19ClN4O2S |
| Molecular Weight | 378.89 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CC[C@@H](NCCn2cncc2-c2[nH]c3ccccc3c2Cl)C1 |
| InChI | InChI=1S/C17H19ClN4O2S/c18-16-13-3-1-2-4-14(13)21-17(16)15-9-19-11-22(15)7-6-20-12-5-8-25(23,24)10-12/h1-4,9,11-12,20-21H,5-8,10H2/t12-/m1/s1 |
| InChIKey | MAVBLRRYLSULHD-GFCCVEGCSA-N |
| XLogP | 2.46 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.89 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine?
The IUPAC name of (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine (CID 92628575) is (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine is O=S1(=O)CC[C@@H](NCCn2cncc2-c2[nH]c3ccccc3c2Cl)C1.
What is the InChIKey of (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine?
The InChIKey is MAVBLRRYLSULHD-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H19ClN4O2S/c18-16-13-3-1-2-4-14(13)21-17(16)15-9-19-11-22(15)7-6-20-12-5-8-25(23,24)10-12/h1-4,9,11-12,20-21H,5-8,10H2/t12-/m1/s1.
What are the key properties of (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine?
(3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine has a molecular weight of 378.89 g/mol, XLogP of 2.46, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-[2-[5-(3-chloro-1H-indol-2-yl)imidazol-1-yl]ethyl]-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 92628575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).