C18H13ClIN3O2 — CID 92648884
2-[2-(4-chlorophenyl)-6-oxo-1H-pyrimidin-5-yl]-N-(4-iodophenyl)acetamide (PubChem CID 92648884) has the molecular formula C18H13ClIN3O2 and a molecular weight of 465.68 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-6-oxo-1H-pyrimidin-5-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-6-oxo-1H-pyrimidin-5-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 92648884 |
| Molecular Formula | C18H13ClIN3O2 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-6-oxo-1H-pyrimidin-5-yl]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(Cc1cnc(-c2ccc(Cl)cc2)[nH]c1=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C18H13ClIN3O2/c19-13-3-1-11(2-4-13)17-21-10-12(18(25)23-17)9-16(24)22-15-7-5-14(20)6-8-15/h1-8,10H,9H2,(H,22,24)(H,21,23,25) |
| InChIKey | RVZLJLXSDDHDRO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|