C18H15ClN2OS — CID 926897
3-(2-chlorophenyl)-N-(2,3-dihydroindole-1-carbothioyl)prop-2-enamide (PubChem CID 926897) has the molecular formula C18H15ClN2OS and a molecular weight of 342.85 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(2,3-dihydroindole-1-carbothioyl)prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-(2,3-dihydroindole-1-carbothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 926897 |
| Molecular Formula | C18H15ClN2OS |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(2,3-dihydroindole-1-carbothioyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)NC(=S)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H15ClN2OS/c19-15-7-3-1-5-13(15)9-10-17(22)20-18(23)21-12-11-14-6-2-4-8-16(14)21/h1-10H,11-12H2,(H,20,22,23) |
| InChIKey | ASVWGMQOCHPKGC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|