C28H35N3O2S — CID 92697278
(2Z)-2-benzylidene-N-[2-[[(2R)-butan-2-yl]-cyclohexylamino]ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 92697278) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-[2-[[(2R)-butan-2-yl]-cyclohexylamino]ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-[2-[[(2R)-butan-2-yl]-cyclohexylamino]ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92697278 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | (2Z)-2-benzylidene-N-[2-[[(2R)-butan-2-yl]-cyclohexylamino]ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CC[C@@H](C)N(CCNC(=O)c1ccc2c(c1)NC(=O)/C(=C/c1ccccc1)S2)C1CCCCC1 |
| InChI | InChI=1S/C28H35N3O2S/c1-3-20(2)31(23-12-8-5-9-13-23)17-16-29-27(32)22-14-15-25-24(19-22)30-28(33)26(34-25)18-21-10-6-4-7-11-21/h4,6-7,10-11,14-15,18-20,23H,3,5,8-9,12-13,16-17H2,1-2H3,(H,29,32)(H,30,33)/b26-18-/t20-/m1/s1 |
| InChIKey | JLQKEALKFLRFTM-CQKAXJAZSA-N |
| XLogP | 5.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|