C25H30N4O3 — CID 92701310
4-(12-ethyl-4-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[(2R)-4-phenylbutan-2-yl]butanamide (PubChem CID 92701310) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-(12-ethyl-4-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[(2R)-4-phenylbutan-2-yl]butanamide.
| Compound Name | 4-(12-ethyl-4-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[(2R)-4-phenylbutan-2-yl]butanamide |
|---|---|
| PubChem CID | 92701310 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-(12-ethyl-4-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[(2R)-4-phenylbutan-2-yl]butanamide |
| SMILES | CCc1nn(CCCC(=O)N[C@H](C)CCc2ccccc2)c(=O)c2cc3oc(C)cc3n12 |
| InChI | InChI=1S/C25H30N4O3/c1-4-23-27-28(25(31)21-16-22-20(29(21)23)15-18(3)32-22)14-8-11-24(30)26-17(2)12-13-19-9-6-5-7-10-19/h5-7,9-10,15-17H,4,8,11-14H2,1-3H3,(H,26,30)/t17-/m1/s1 |
| InChIKey | SHOVPKJSLOFNKP-QGZVFWFLSA-N |
| XLogP | 4.03 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |