C23H24BrN3O2 — CID 92768333
4-[(S)-(4-bromophenyl)-phenylmethyl]-N-(furan-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 92768333) has the molecular formula C23H24BrN3O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is 4-[(S)-(4-bromophenyl)-phenylmethyl]-N-(furan-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-[(S)-(4-bromophenyl)-phenylmethyl]-N-(furan-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 92768333 |
| Molecular Formula | C23H24BrN3O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 4-[(S)-(4-bromophenyl)-phenylmethyl]-N-(furan-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccco1)N1CCN([C@@H](c2ccccc2)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C23H24BrN3O2/c24-20-10-8-19(9-11-20)22(18-5-2-1-3-6-18)26-12-14-27(15-13-26)23(28)25-17-21-7-4-16-29-21/h1-11,16,22H,12-15,17H2,(H,25,28)/t22-/m0/s1 |
| InChIKey | XKGFNGGRQLEKLN-QFIPXVFZSA-N |
| XLogP | 4.66 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |