C12H11Cl3IN3OS — CID 92836395
N-[(1S)-2,2,2-trichloro-1-[(4-iodophenyl)carbamothioylamino]ethyl]prop-2-enamide (PubChem CID 92836395) has the molecular formula C12H11Cl3IN3OS and a molecular weight of 478.57 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[(4-iodophenyl)carbamothioylamino]ethyl]prop-2-enamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[(4-iodophenyl)carbamothioylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 92836395 |
| Molecular Formula | C12H11Cl3IN3OS |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 476.87 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[(4-iodophenyl)carbamothioylamino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H](NC(=S)Nc1ccc(I)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H11Cl3IN3OS/c1-2-9(20)18-10(12(13,14)15)19-11(21)17-8-5-3-7(16)4-6-8/h2-6,10H,1H2,(H,18,20)(H2,17,19,21)/t10-/m0/s1 |
| InChIKey | TZJLVFRUINNXCO-JTQLQIEISA-N |
| XLogP | 3.58 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|