C13H16N5+ — CID 9284568
4-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-methylphenyl)-1H-pyrazol-2-ium-3-amine (PubChem CID 9284568) has the molecular formula C13H16N5+ and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-methylphenyl)-1H-pyrazol-2-ium-3-amine.
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-methylphenyl)-1H-pyrazol-2-ium-3-amine |
|---|---|
| PubChem CID | 9284568 |
| Molecular Formula | C13H16N5+ |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-2-(4-methylphenyl)-1H-pyrazol-2-ium-3-amine |
| SMILES | Cc1ccc(-[n+]2[nH]cc(C3=NCCN3)c2N)cc1 |
| InChI | InChI=1S/C13H15N5/c1-9-2-4-10(5-3-9)18-12(14)11(8-17-18)13-15-6-7-16-13/h2-5,8H,6-7H2,1H3,(H3,14,15,16,17)/p+1 |
| InChIKey | FYAVINGRWRNDQU-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|