C32H35N3O6 — CID 92906179
2-methylpropyl 4-[[5-[(Z)-[(2-benzamido-3-methylbut-2-enoyl)hydrazinylidene]methyl]-2-methoxyphenyl]methoxy]benzoate (PubChem CID 92906179) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is 2-methylpropyl 4-[[5-[(Z)-[(2-benzamido-3-methylbut-2-enoyl)hydrazinylidene]methyl]-2-methoxyphenyl]methoxy]benzoate.
| Compound Name | 2-methylpropyl 4-[[5-[(Z)-[(2-benzamido-3-methylbut-2-enoyl)hydrazinylidene]methyl]-2-methoxyphenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 92906179 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 2-methylpropyl 4-[[5-[(Z)-[(2-benzamido-3-methylbut-2-enoyl)hydrazinylidene]methyl]-2-methoxyphenyl]methoxy]benzoate |
| SMILES | COc1ccc(/C=N\NC(=O)C(NC(=O)c2ccccc2)=C(C)C)cc1COc1ccc(C(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C32H35N3O6/c1-21(2)19-41-32(38)25-12-14-27(15-13-25)40-20-26-17-23(11-16-28(26)39-5)18-33-35-31(37)29(22(3)4)34-30(36)24-9-7-6-8-10-24/h6-18,21H,19-20H2,1-5H3,(H,34,36)(H,35,37)/b33-18- |
| InChIKey | ILVUUPVWXUMNHF-OHUYPAJKSA-N |
| XLogP | 5.26 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|