C16H19NO4S — CID 92936606
methyl 2-amino-4-(2,5-dimethoxyphenyl)-5-ethylthiophene-3-carboxylate (PubChem CID 92936606) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is methyl 2-amino-4-(2,5-dimethoxyphenyl)-5-ethylthiophene-3-carboxylate.
| Compound Name | methyl 2-amino-4-(2,5-dimethoxyphenyl)-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 92936606 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | methyl 2-amino-4-(2,5-dimethoxyphenyl)-5-ethylthiophene-3-carboxylate |
| SMILES | CCc1sc(N)c(C(=O)OC)c1-c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H19NO4S/c1-5-12-13(14(15(17)22-12)16(18)21-4)10-8-9(19-2)6-7-11(10)20-3/h6-8H,5,17H2,1-4H3 |
| InChIKey | UARHHKCACAKZFA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|