C20H18FN3O3 — CID 9293770
(E)-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 9293770) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is (E)-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9293770 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (E)-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(NC(=O)/C=C/c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C20H18FN3O3/c1-2-20(15-8-4-3-5-9-15)18(26)24(19(27)22-20)23-17(25)12-11-14-7-6-10-16(21)13-14/h3-13H,2H2,1H3,(H,22,27)(H,23,25)/b12-11+/t20-/m0/s1 |
| InChIKey | AOPKBNMXNDXSMT-SGWGQVFISA-N |
| XLogP | 2.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|