C16H19BrN2O2S — CID 92991155
(3S)-1-(4-bromo-2-methylphenyl)-3-(thiomorpholine-4-carbonyl)pyrrolidin-2-one (PubChem CID 92991155) has the molecular formula C16H19BrN2O2S and a molecular weight of 383.31 g/mol. Its IUPAC name is (3S)-1-(4-bromo-2-methylphenyl)-3-(thiomorpholine-4-carbonyl)pyrrolidin-2-one.
| Compound Name | (3S)-1-(4-bromo-2-methylphenyl)-3-(thiomorpholine-4-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 92991155 |
| Molecular Formula | C16H19BrN2O2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | (3S)-1-(4-bromo-2-methylphenyl)-3-(thiomorpholine-4-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1cc(Br)ccc1N1CC[C@@H](C(=O)N2CCSCC2)C1=O |
| InChI | InChI=1S/C16H19BrN2O2S/c1-11-10-12(17)2-3-14(11)19-5-4-13(16(19)21)15(20)18-6-8-22-9-7-18/h2-3,10,13H,4-9H2,1H3/t13-/m0/s1 |
| InChIKey | MYFHFHGFOUQJBT-ZDUSSCGKSA-N |
| XLogP | 2.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|