C11H18N4S — CID 93032930
1,3-bis[(E)-[(Z)-2-methylbut-2-enylidene]amino]thiourea (PubChem CID 93032930) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 1,3-bis[(E)-[(Z)-2-methylbut-2-enylidene]amino]thiourea.
| Compound Name | 1,3-bis[(E)-[(Z)-2-methylbut-2-enylidene]amino]thiourea |
|---|---|
| PubChem CID | 93032930 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1,3-bis[(E)-[(Z)-2-methylbut-2-enylidene]amino]thiourea |
| SMILES | C/C=C(C)\C=N\NC(=S)N/N=C/C(C)=C\C |
| InChI | InChI=1S/C11H18N4S/c1-5-9(3)7-12-14-11(16)15-13-8-10(4)6-2/h5-8H,1-4H3,(H2,14,15,16)/b9-5-,10-6-,12-7+,13-8+ |
| InChIKey | VKKBIRXLLDWTPL-CJIVFJLOSA-N |
| XLogP | 2.35 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|