C18H13N3O2 — CID 930888
10-(3-methylphenyl)pyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 930888) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 10-(3-methylphenyl)pyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 10-(3-methylphenyl)pyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 930888 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 10-(3-methylphenyl)pyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | Cc1cccc(-n2c3nc(=O)[nH]c(=O)c-3cc3ccccc32)c1 |
| InChI | InChI=1S/C18H13N3O2/c1-11-5-4-7-13(9-11)21-15-8-3-2-6-12(15)10-14-16(21)19-18(23)20-17(14)22/h2-10H,1H3,(H,20,22,23) |
| InChIKey | MPCFHHRLITZGNC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|