C18H9FN4O2 — CID 71819007
10-(3-fluorophenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile (PubChem CID 71819007) has the molecular formula C18H9FN4O2 and a molecular weight of 332.29 g/mol. Its IUPAC name is 10-(3-fluorophenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile.
| Compound Name | 10-(3-fluorophenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 71819007 |
| Molecular Formula | C18H9FN4O2 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 10-(3-fluorophenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile |
| SMILES | N#Cc1ccc2cc3c(=O)[nH]c(=O)nc-3n(-c3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C18H9FN4O2/c19-12-2-1-3-13(8-12)23-15-6-10(9-20)4-5-11(15)7-14-16(23)21-18(25)22-17(14)24/h1-8H,(H,22,24,25) |
| InChIKey | VKJADGNTZGKQPY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|