C21H14N4O2 — CID 56726645
14-methyl-2-phenyl-2,4,6,18-tetrazatetracyclo[8.8.0.03,8.012,17]octadeca-1(10),3,8,11,13,15,17-heptaene-5,7-dione (PubChem CID 56726645) has the molecular formula C21H14N4O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 14-methyl-2-phenyl-2,4,6,18-tetrazatetracyclo[8.8.0.03,8.012,17]octadeca-1(10),3,8,11,13,15,17-heptaene-5,7-dione.
| Compound Name | 14-methyl-2-phenyl-2,4,6,18-tetrazatetracyclo[8.8.0.03,8.012,17]octadeca-1(10),3,8,11,13,15,17-heptaene-5,7-dione |
|---|---|
| PubChem CID | 56726645 |
| Molecular Formula | C21H14N4O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 14-methyl-2-phenyl-2,4,6,18-tetrazatetracyclo[8.8.0.03,8.012,17]octadeca-1(10),3,8,11,13,15,17-heptaene-5,7-dione |
| SMILES | Cc1ccc2nc3c(cc4c(=O)[nH]c(=O)nc-4n3-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C21H14N4O2/c1-12-7-8-17-13(9-12)10-14-11-16-19(23-21(27)24-20(16)26)25(18(14)22-17)15-5-3-2-4-6-15/h2-11H,1H3,(H,24,26,27) |
| InChIKey | VXWVXIGWFKLHAT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|