C17H21BrFN3OS2 — CID 93126133
(2S)-N-[5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-ethylhexanamide (PubChem CID 93126133) has the molecular formula C17H21BrFN3OS2 and a molecular weight of 446.41 g/mol. Its IUPAC name is (2S)-N-[5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-ethylhexanamide.
| Compound Name | (2S)-N-[5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-ethylhexanamide |
|---|---|
| PubChem CID | 93126133 |
| Molecular Formula | C17H21BrFN3OS2 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | (2S)-N-[5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-ethylhexanamide |
| SMILES | CCCC[C@H](CC)C(=O)Nc1nnc(SCc2ccc(Br)cc2F)s1 |
| InChI | InChI=1S/C17H21BrFN3OS2/c1-3-5-6-11(4-2)15(23)20-16-21-22-17(25-16)24-10-12-7-8-13(18)9-14(12)19/h7-9,11H,3-6,10H2,1-2H3,(H,20,21,23)/t11-/m0/s1 |
| InChIKey | PXADUUCVJLIXDF-NSHDSACASA-N |
| XLogP | 5.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|