C16H16N4O4 — CID 9323375
N'-[2-(4-cyanophenoxy)acetyl]-3-ethyl-5-methyl-1,2-oxazole-4-carbohydrazide (PubChem CID 9323375) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is N'-[2-(4-cyanophenoxy)acetyl]-3-ethyl-5-methyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | N'-[2-(4-cyanophenoxy)acetyl]-3-ethyl-5-methyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9323375 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N'-[2-(4-cyanophenoxy)acetyl]-3-ethyl-5-methyl-1,2-oxazole-4-carbohydrazide |
| SMILES | CCc1noc(C)c1C(=O)NNC(=O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H16N4O4/c1-3-13-15(10(2)24-20-13)16(22)19-18-14(21)9-23-12-6-4-11(8-17)5-7-12/h4-7H,3,9H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | BJMDRXOXVJEKHI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|