C19H17N7O3 — CID 9324140
2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]acetamide (PubChem CID 9324140) has the molecular formula C19H17N7O3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]acetamide.
| Compound Name | 2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 9324140 |
| Molecular Formula | C19H17N7O3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]acetamide |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2cccc(-c3nn[nH]n3)c2)C1=O |
| InChI | InChI=1S/C19H17N7O3/c1-19(13-7-3-2-4-8-13)17(28)26(18(29)21-19)11-15(27)20-14-9-5-6-12(10-14)16-22-24-25-23-16/h2-10H,11H2,1H3,(H,20,27)(H,21,29)(H,22,23,24,25)/t19-/m0/s1 |
| InChIKey | NYUZDTGHKGLQOC-IBGZPJMESA-N |
| XLogP | 1.27 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|