C17H20N4O5S — CID 9331832
N-[(2S)-1-methoxypropan-2-yl]-4-[(pyridine-2-carbonylamino)carbamoyl]benzenesulfonamide (PubChem CID 9331832) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[(2S)-1-methoxypropan-2-yl]-4-[(pyridine-2-carbonylamino)carbamoyl]benzenesulfonamide.
| Compound Name | N-[(2S)-1-methoxypropan-2-yl]-4-[(pyridine-2-carbonylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9331832 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[(2S)-1-methoxypropan-2-yl]-4-[(pyridine-2-carbonylamino)carbamoyl]benzenesulfonamide |
| SMILES | COC[C@H](C)NS(=O)(=O)c1ccc(C(=O)NNC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C17H20N4O5S/c1-12(11-26-2)21-27(24,25)14-8-6-13(7-9-14)16(22)19-20-17(23)15-5-3-4-10-18-15/h3-10,12,21H,11H2,1-2H3,(H,19,22)(H,20,23)/t12-/m0/s1 |
| InChIKey | OIHRDGYAEXAVCT-LBPRGKRZSA-N |
| XLogP | 0.47 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|