C15H18N3O3S+ — CID 9332347
(5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl-(furan-2-ylmethyl)-methylazanium (PubChem CID 9332347) has the molecular formula C15H18N3O3S+ and a molecular weight of 320.39 g/mol. Its IUPAC name is (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl-(furan-2-ylmethyl)-methylazanium.
| Compound Name | (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl-(furan-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 9332347 |
| Molecular Formula | C15H18N3O3S+ |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl-(furan-2-ylmethyl)-methylazanium |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1C[NH+](C)Cc1ccco1 |
| InChI | InChI=1S/C15H17N3O3S/c1-3-20-15(19)13-12(11(7-16)14(17)22-13)9-18(2)8-10-5-4-6-21-10/h4-6H,3,8-9,17H2,1-2H3/p+1 |
| InChIKey | IGYZPFXIBDGBHF-UHFFFAOYSA-O |
| XLogP | 1.19 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |