C18H25N5O4S — CID 9368233
N-[2-[2-[[(2R)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 9368233) has the molecular formula C18H25N5O4S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[2-[2-[[(2R)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-[2-[[(2R)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 9368233 |
| Molecular Formula | C18H25N5O4S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[2-[2-[[(2R)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | COC[C@@H](C)NC(=S)NNC(=O)CNC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H25N5O4S/c1-12(11-27-2)20-18(28)22-21-15(24)10-19-17(26)13-5-7-14(8-6-13)23-9-3-4-16(23)25/h5-8,12H,3-4,9-11H2,1-2H3,(H,19,26)(H,21,24)(H2,20,22,28)/t12-/m1/s1 |
| InChIKey | ISMSLFCGXLDGAE-GFCCVEGCSA-N |
| XLogP | 0.07 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|