C18H25NO5S — CID 9385372
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetate (PubChem CID 9385372) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 9385372 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)CSCc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C18H25NO5S/c1-6-7-19-18(21)13(3)24-17(20)11-25-10-14-9-16(23-5)15(22-4)8-12(14)2/h6,8-9,13H,1,7,10-11H2,2-5H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | YCGHGPKMZFIYMK-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|