C16H26F6N2O2 — CID 94035120
(2R,3R)-N,N,N',N'-tetraethyl-2-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pentanediamide (PubChem CID 94035120) has the molecular formula C16H26F6N2O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is (2R,3R)-N,N,N',N'-tetraethyl-2-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pentanediamide.
| Compound Name | (2R,3R)-N,N,N',N'-tetraethyl-2-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pentanediamide |
|---|---|
| PubChem CID | 94035120 |
| Molecular Formula | C16H26F6N2O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (2R,3R)-N,N,N',N'-tetraethyl-2-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pentanediamide |
| SMILES | CCN(CC)C(=O)C[C@H]([C@@H](CC(F)(F)F)C(=O)N(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C16H26F6N2O2/c1-5-23(6-2)13(25)9-12(16(20,21)22)11(10-15(17,18)19)14(26)24(7-3)8-4/h11-12H,5-10H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | ZISXYTBEXWOPPY-VXGBXAGGSA-N |
| XLogP | 3.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |