C9H16O2 — CID 94036836
[(1R,2R)-2-(hydroxymethyl)-3-propan-2-ylidenecyclobutyl]methanol (PubChem CID 94036836) has the molecular formula C9H16O2 and a molecular weight of 156.23 g/mol. Its IUPAC name is [(1R,2R)-2-(hydroxymethyl)-3-propan-2-ylidenecyclobutyl]methanol.
| Compound Name | [(1R,2R)-2-(hydroxymethyl)-3-propan-2-ylidenecyclobutyl]methanol |
|---|---|
| PubChem CID | 94036836 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | [(1R,2R)-2-(hydroxymethyl)-3-propan-2-ylidenecyclobutyl]methanol |
| SMILES | CC(C)=C1C[C@@H](CO)[C@H]1CO |
| InChI | InChI=1S/C9H16O2/c1-6(2)8-3-7(4-10)9(8)5-11/h7,9-11H,3-5H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | GUOUPFBCAQNXID-IONNQARKSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|